| C00004655 - Boesenbergia pandurata | |
| C_ID | C00004655 |
| CAS RN | 1247-97-8 |
| Metabolite | 3,5,7,3',4'-Pentamethoxyflavone;Quercetin pentamethyl ether |
| Molecular Formula | C20H20O7 |
| Organism | Boesenbergia pandurata |
| Kingdom | Plantae |
| Family | Zingiberaceae |
| Genus | Boesenbergia |
| SMILES | c1(cc(c2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)OC)OC)OC)OC |
| InChI | InChI=1S/C20H20O7/c1-22-12-9-15(25-4)17-16(10-12)27-19(20(26-5)18(17)21)11-6-7-13(23-2)14(8-11)24-3/h6-10H,1-5H3 |
| InChIKey | ALGDHWVALRSLBT-UHFFFAOYSA-N |
| Reference | Chen, et al., Lexicon of Active Componentsin in Plants, Vol 3, Medicinal Science and Technology Press of China, Beijing, (2001) |
| Structural formula |  |