| C00007290 - Typha angustifolia | |
| C_ID | C00007290 |
| CAS RN | 58-86-6 |
| Metabolite | Xylose;D-(+)-Xylose |
| Molecular Formula | C5H10O5 |
| Organism | Typha angustifolia |
| Kingdom | Plantae |
| Family | Typhaceae |
| Genus | Typha |
| SMILES | C1[C@H]([C@H]([C@@H]([C@@H](O1)O)O)O)O |
| InChI | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5-/m1/s1 |
| InChIKey | SRBFZHDQGSBBOR-WMJLAQOENA-N |
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).;Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
| Structural formula |  |